C11H11NO4 — CID 54082644
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) acetate (PubChem CID 54082644) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) acetate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) acetate |
|---|---|
| PubChem CID | 54082644 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) acetate |
| SMILES | CC(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C11H11NO4/c1-5(13)16-12-10(14)8-6-2-3-7(4-6)9(8)11(12)15/h2-3,6-7,14-15H,4H2,1H3 |
| InChIKey | MOEQDFMWGSRYEG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|