C16H24N2 — CID 54082762
2,3,4-triethyl-5-(3-ethyl-1H-pyrrol-2-yl)-1H-pyrrole (PubChem CID 54082762) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2,3,4-triethyl-5-(3-ethyl-1H-pyrrol-2-yl)-1H-pyrrole.
| Compound Name | 2,3,4-triethyl-5-(3-ethyl-1H-pyrrol-2-yl)-1H-pyrrole |
|---|---|
| PubChem CID | 54082762 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2,3,4-triethyl-5-(3-ethyl-1H-pyrrol-2-yl)-1H-pyrrole |
| SMILES | CCc1cc[nH]c1-c1[nH]c(CC)c(CC)c1CC |
| InChI | InChI=1S/C16H24N2/c1-5-11-9-10-17-15(11)16-13(7-3)12(6-2)14(8-4)18-16/h9-10,17-18H,5-8H2,1-4H3 |
| InChIKey | MOGWYAIZCHMJKU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |