C65H94N6O7S3 — CID 54094191
2,3-dihydroxypropyl 2,2,3-tris[4-(5-nonyl-1,3,4-thiadiazol-2-yl)phenoxy]undecanoate (PubChem CID 54094191) has the molecular formula C65H94N6O7S3 and a molecular weight of 1167.70 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2,2,3-tris[4-(5-nonyl-1,3,4-thiadiazol-2-yl)phenoxy]undecanoate.
| Compound Name | 2,3-dihydroxypropyl 2,2,3-tris[4-(5-nonyl-1,3,4-thiadiazol-2-yl)phenoxy]undecanoate |
|---|---|
| PubChem CID | 54094191 |
| Molecular Formula | C65H94N6O7S3 |
| Molecular Weight | 1167.70 g/mol |
| Exact Mass | 1166.63 |
| IUPAC Name | 2,3-dihydroxypropyl 2,2,3-tris[4-(5-nonyl-1,3,4-thiadiazol-2-yl)phenoxy]undecanoate |
| SMILES | CCCCCCCCCc1nnc(-c2ccc(OC(CCCCCCCC)C(Oc3ccc(-c4nnc(CCCCCCCCC)s4)cc3)(Oc3ccc(-c4nnc(CCCCCCCCC)s4)cc3)C(=O)OCC(O)CO)cc2)s1 |
| InChI | InChI=1S/C65H94N6O7S3/c1-5-9-13-17-21-25-29-33-58-66-69-61(79-58)50-36-42-54(43-37-50)76-57(32-28-24-20-16-12-8-4)65(64(74)75-49-53(73)48-72,77-55-44-38-51(39-45-55)62-70-67-59(80-62)34-30-26-22-18-14-10-6-2)78-56-46-40-52(41-47-56)63-71-68-60(81-63)35-31-27-23-19-15-11-7-3/h36-47,53,57,72-73H,5-35,48-49H2,1-4H3 |
| InChIKey | MVYCKRCWVUGFFM-UHFFFAOYSA-N |
| XLogP | 17.37 |
| TPSA | 171.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.70 |
| LogP ≤ 5 | 17.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|