C23H31N3O2S — CID 67941421
[4-(5-heptyl-1,3,4-thiadiazol-2-yl)phenyl] (2S,3R)-3-cyano-2-methylhexanoate (PubChem CID 67941421) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is [4-(5-heptyl-1,3,4-thiadiazol-2-yl)phenyl] (2S,3R)-3-cyano-2-methylhexanoate.
| Compound Name | [4-(5-heptyl-1,3,4-thiadiazol-2-yl)phenyl] (2S,3R)-3-cyano-2-methylhexanoate |
|---|---|
| PubChem CID | 67941421 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | [4-(5-heptyl-1,3,4-thiadiazol-2-yl)phenyl] (2S,3R)-3-cyano-2-methylhexanoate |
| SMILES | CCCCCCCc1nnc(-c2ccc(OC(=O)[C@@H](C)[C@H](C#N)CCC)cc2)s1 |
| InChI | InChI=1S/C23H31N3O2S/c1-4-6-7-8-9-11-21-25-26-22(29-21)18-12-14-20(15-13-18)28-23(27)17(3)19(16-24)10-5-2/h12-15,17,19H,4-11H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | XKJIBGTXXXDCFX-HKUYNNGSSA-N |
| XLogP | 6.20 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|