C19H30N2O3S — CID 54104977
(2R)-4-[4-[methyl(propan-2-yl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioic S-acid (PubChem CID 54104977) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is (2R)-4-[4-[methyl(propan-2-yl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioic S-acid.
| Compound Name | (2R)-4-[4-[methyl(propan-2-yl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioic S-acid |
|---|---|
| PubChem CID | 54104977 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (2R)-4-[4-[methyl(propan-2-yl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanethioic S-acid |
| SMILES | CC(C)N(C)c1ccc(CC[C@@H](NC(=O)OC(C)(C)C)C(=O)S)cc1 |
| InChI | InChI=1S/C19H30N2O3S/c1-13(2)21(6)15-10-7-14(8-11-15)9-12-16(17(22)25)20-18(23)24-19(3,4)5/h7-8,10-11,13,16H,9,12H2,1-6H3,(H,20,23)(H,22,25)/t16-/m1/s1 |
| InChIKey | NDCPBKKLDYDCJN-MRXNPFEDSA-N |
| XLogP | 3.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|