C19H28N2O6S — CID 139815836
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[5-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-pyridinyl]butanethioic S-acid (PubChem CID 139815836) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[5-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-pyridinyl]butanethioic S-acid.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[5-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-pyridinyl]butanethioic S-acid |
|---|---|
| PubChem CID | 139815836 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[5-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-pyridinyl]butanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCc1ccc(OC(=O)OC(C)(C)C)cn1)C(=O)S |
| InChI | InChI=1S/C19H28N2O6S/c1-18(2,3)26-16(23)21-14(15(22)28)10-8-12-7-9-13(11-20-12)25-17(24)27-19(4,5)6/h7,9,11,14H,8,10H2,1-6H3,(H,21,23)(H,22,28)/t14-/m1/s1 |
| InChIKey | IIPVNYMLIKAEQH-CQSZACIVSA-N |
| XLogP | 3.68 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|