C15H18N2O5 — CID 54109675
1-[2-(3,4-dimethoxyphenyl)propyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 54109675) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)propyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)propyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54109675 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)propyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1ccc(C(C)Cn2c(O)cc(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C15H18N2O5/c1-9(8-17-14(19)7-13(18)16-15(17)20)10-4-5-11(21-2)12(6-10)22-3/h4-7,9,19H,8H2,1-3H3,(H,16,18,20) |
| InChIKey | NGFAAZFVPMNWTR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |