C25H35N3O3 — CID 54115352
1-[[(4R,5R)-2-(4-aminophenyl)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 54115352) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[[(4R,5R)-2-(4-aminophenyl)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[[(4R,5R)-2-(4-aminophenyl)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 54115352 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 1-[[(4R,5R)-2-(4-aminophenyl)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC1(c2ccc(N)cc2)O[C@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C25H35N3O3/c1-15(2)21-8-7-9-22(16(3)4)23(21)28-24(29)27-14-25(30-17(5)18(6)31-25)19-10-12-20(26)13-11-19/h7-13,15-18H,14,26H2,1-6H3,(H2,27,28,29)/t17-,18-/m1/s1 |
| InChIKey | NJYSTNOUSQBETB-QZTJIDSGSA-N |
| XLogP | 5.31 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|