C16H15NO7S2 — CID 54115642
2-[5-[(3,4-diacetyloxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (PubChem CID 54115642) has the molecular formula C16H15NO7S2 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[5-[(3,4-diacetyloxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[5-[(3,4-diacetyloxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 54115642 |
| Molecular Formula | C16H15NO7S2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-[5-[(3,4-diacetyloxyphenyl)methyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| SMILES | CC(=O)Oc1ccc(Cc2sc(=S)n(CC(=O)O)c2O)cc1OC(C)=O |
| InChI | InChI=1S/C16H15NO7S2/c1-8(18)23-11-4-3-10(5-12(11)24-9(2)19)6-13-15(22)17(7-14(20)21)16(25)26-13/h3-5,22H,6-7H2,1-2H3,(H,20,21) |
| InChIKey | NKDSDMIBGRGLIW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|