2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid

C15H22N2O2 — CID 54125576

IUPAC2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid
SMILESCCC/N=C(\NCCC)c1ccc(CC(=O)O)cc1
InChIInChI=1S/C15H22N2O2/c1-3-9-16-15(17-10-4-2)13-7-5-12(6-8-13)11-14(18)19/h5-8H,3-4,9-11H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyNQSLMUCYAIMOQR-UHFFFAOYSA-N
MW262.35 g/mol
LogP2.47
Rot. Bonds7

About 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid

2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid (PubChem CID 54125576) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid.

Molecular Properties

Compound Name2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid
PubChem CID54125576
Molecular FormulaC15H22N2O2
Molecular Weight262.35 g/mol
Exact Mass262.17
IUPAC Name2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid
SMILESCCC/N=C(\NCCC)c1ccc(CC(=O)O)cc1
InChIInChI=1S/C15H22N2O2/c1-3-9-16-15(17-10-4-2)13-7-5-12(6-8-13)11-14(18)19/h5-8H,3-4,9-11H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyNQSLMUCYAIMOQR-UHFFFAOYSA-N
XLogP2.47
TPSA61.69 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 52.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
The IUPAC name of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid (CID 54125576) is 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid.
What is the SMILES notation for 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
The canonical SMILES for 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid is CCC/N=C(\NCCC)c1ccc(CC(=O)O)cc1.
What is the InChIKey of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
The InChIKey is NQSLMUCYAIMOQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-3-9-16-15(17-10-4-2)13-7-5-12(6-8-13)11-14(18)19/h5-8H,3-4,9-11H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid has a molecular weight of 262.35 g/mol, XLogP of 2.47, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid is sourced from PubChem (CID 54125576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).