About 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid
2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid (PubChem CID 54125576) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid |
| PubChem CID | 54125576 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid |
| SMILES | CCC/N=C(\NCCC)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-9-16-15(17-10-4-2)13-7-5-12(6-8-13)11-14(18)19/h5-8H,3-4,9-11H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | NQSLMUCYAIMOQR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
The IUPAC name of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid (CID 54125576) is 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid.
What is the SMILES notation for 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
The canonical SMILES for 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid is CCC/N=C(\NCCC)c1ccc(CC(=O)O)cc1.
What is the InChIKey of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
The InChIKey is NQSLMUCYAIMOQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-3-9-16-15(17-10-4-2)13-7-5-12(6-8-13)11-14(18)19/h5-8H,3-4,9-11H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid?
2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid has a molecular weight of 262.35 g/mol, XLogP of 2.47, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(N,N'-dipropylcarbamimidoyl)phenyl]acetic acid is sourced from PubChem (CID 54125576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).