C21H23NO2 — CID 5412567
(2E)-1-(4-methoxyphenyl)-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)ethanone (PubChem CID 5412567) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2E)-1-(4-methoxyphenyl)-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)ethanone.
| Compound Name | (2E)-1-(4-methoxyphenyl)-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)ethanone |
|---|---|
| PubChem CID | 5412567 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2E)-1-(4-methoxyphenyl)-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)ethanone |
| SMILES | COc1ccc(C(=O)/C=C2\c3ccccc3CC(C)(C)N2C)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-21(2)14-16-7-5-6-8-18(16)19(22(21)3)13-20(23)15-9-11-17(24-4)12-10-15/h5-13H,14H2,1-4H3/b19-13+ |
| InChIKey | AFNRNLJHETZADJ-CPNJWEJPSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|