C22H24O2S — CID 177421423
S-[(2-but-3-enyl-1,3-dihydroinden-2-yl)methyl] 4-methoxybenzenecarbothioate (PubChem CID 177421423) has the molecular formula C22H24O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is S-[(2-but-3-enyl-1,3-dihydroinden-2-yl)methyl] 4-methoxybenzenecarbothioate.
| Compound Name | S-[(2-but-3-enyl-1,3-dihydroinden-2-yl)methyl] 4-methoxybenzenecarbothioate |
|---|---|
| PubChem CID | 177421423 |
| Molecular Formula | C22H24O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | S-[(2-but-3-enyl-1,3-dihydroinden-2-yl)methyl] 4-methoxybenzenecarbothioate |
| SMILES | C=CCCC1(CSC(=O)c2ccc(OC)cc2)Cc2ccccc2C1 |
| InChI | InChI=1S/C22H24O2S/c1-3-4-13-22(14-18-7-5-6-8-19(18)15-22)16-25-21(23)17-9-11-20(24-2)12-10-17/h3,5-12H,1,4,13-16H2,2H3 |
| InChIKey | PUPDPWLJAHVJSI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|