C18H16N2O5 — CID 5412583
(3R)-3-[(2E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyiminoethyl]-3-hydroxy-1H-indol-2-one (PubChem CID 5412583) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is (3R)-3-[(2E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyiminoethyl]-3-hydroxy-1H-indol-2-one.
| Compound Name | (3R)-3-[(2E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyiminoethyl]-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 5412583 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (3R)-3-[(2E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxyiminoethyl]-3-hydroxy-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2[C@]1(O)C/C(=N\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H16N2O5/c21-17-18(22,12-3-1-2-4-13(12)19-17)10-14(20-23)11-5-6-15-16(9-11)25-8-7-24-15/h1-6,9,22-23H,7-8,10H2,(H,19,21)/b20-14+/t18-/m1/s1 |
| InChIKey | IFFKGGLFZHXPPC-SQVRNEIYSA-N |
| XLogP | 1.87 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|