C12H17NO3 — CID 54126529
7-(2,4-dihydroxy-3-azabicyclo[3.1.0]hexa-1,4-dien-3-yl)heptanal (PubChem CID 54126529) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 7-(2,4-dihydroxy-3-azabicyclo[3.1.0]hexa-1,4-dien-3-yl)heptanal.
| Compound Name | 7-(2,4-dihydroxy-3-azabicyclo[3.1.0]hexa-1,4-dien-3-yl)heptanal |
|---|---|
| PubChem CID | 54126529 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 7-(2,4-dihydroxy-3-azabicyclo[3.1.0]hexa-1,4-dien-3-yl)heptanal |
| SMILES | O=CCCCCCCn1c(O)c2c(c1O)C2 |
| InChI | InChI=1S/C12H17NO3/c14-7-5-3-1-2-4-6-13-11(15)9-8-10(9)12(13)16/h7,15-16H,1-6,8H2 |
| InChIKey | NRIMZTLYFKWPNM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|