C12H17F2NO2 — CID 54434876
3-(7,7-difluoroheptyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 54434876) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 3-(7,7-difluoroheptyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 3-(7,7-difluoroheptyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 54434876 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-(7,7-difluoroheptyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | Oc1c2c(c(O)n1CCCCCCC(F)F)C2 |
| InChI | InChI=1S/C12H17F2NO2/c13-10(14)5-3-1-2-4-6-15-11(16)8-7-9(8)12(15)17/h10,16-17H,1-7H2 |
| InChIKey | WKALDUSDUGVQQT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|