C17H31NO3Si — CID 54138019
3-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 54138019) has the molecular formula C17H31NO3Si and a molecular weight of 325.53 g/mol. Its IUPAC name is 3-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 3-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 54138019 |
| Molecular Formula | C17H31NO3Si |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 3-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCn1c(O)c2c(c1O)C2 |
| InChI | InChI=1S/C17H31NO3Si/c1-17(2,3)22(4,5)21-11-9-7-6-8-10-18-15(19)13-12-14(13)16(18)20/h19-20H,6-12H2,1-5H3 |
| InChIKey | NZCFPAIMOXAEDX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|