C12H17NO2 — CID 54207313
3-hept-6-enyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 54207313) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-hept-6-enyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 3-hept-6-enyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 54207313 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-hept-6-enyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | C=CCCCCCn1c(O)c2c(c1O)C2 |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-5-6-7-13-11(14)9-8-10(9)12(13)15/h2,14-15H,1,3-8H2 |
| InChIKey | PTKGEFFGSBXZNS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|