C11H16FNO2 — CID 54504455
3-(6-fluorohexyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 54504455) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is 3-(6-fluorohexyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 3-(6-fluorohexyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 54504455 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(6-fluorohexyl)-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | Oc1c2c(c(O)n1CCCCCCF)C2 |
| InChI | InChI=1S/C11H16FNO2/c12-5-3-1-2-4-6-13-10(14)8-7-9(8)11(13)15/h14-15H,1-7H2 |
| InChIKey | YESDICIVNVWZRE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|