C33H54O7 — CID 54130165
4-[(3R)-3-[[(1R,2S)-2-[3-(1-butylcyclopropyl)propyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,2-bis(oxan-2-yloxy)butanoic acid (PubChem CID 54130165) has the molecular formula C33H54O7 and a molecular weight of 562.79 g/mol. Its IUPAC name is 4-[(3R)-3-[[(1R,2S)-2-[3-(1-butylcyclopropyl)propyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,2-bis(oxan-2-yloxy)butanoic acid.
| Compound Name | 4-[(3R)-3-[[(1R,2S)-2-[3-(1-butylcyclopropyl)propyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,2-bis(oxan-2-yloxy)butanoic acid |
|---|---|
| PubChem CID | 54130165 |
| Molecular Formula | C33H54O7 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | 4-[(3R)-3-[[(1R,2S)-2-[3-(1-butylcyclopropyl)propyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,2-bis(oxan-2-yloxy)butanoic acid |
| SMILES | C=C1CC[C@H](CCCC2(CCCC)CC2)[C@H]1C[C@H]1OC1CCC(OC1CCCCO1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C33H54O7/c1-3-4-16-32(19-20-32)17-9-10-25-14-13-24(2)26(25)23-28-27(38-28)15-18-33(31(34)35,39-29-11-5-7-21-36-29)40-30-12-6-8-22-37-30/h25-30H,2-23H2,1H3,(H,34,35)/t25-,26-,27?,28+,29?,30?,33?/m0/s1 |
| InChIKey | NTTYERKMNJSTPC-LDUOMMILSA-N |
| XLogP | 7.51 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|