C35H56O7 — CID 54243335
4-[(3R)-3-[[(1R,2S)-2-(5,9-dimethyldec-8-enyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid (PubChem CID 54243335) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is 4-[(3R)-3-[[(1R,2S)-2-(5,9-dimethyldec-8-enyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid.
| Compound Name | 4-[(3R)-3-[[(1R,2S)-2-(5,9-dimethyldec-8-enyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 54243335 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | 4-[(3R)-3-[[(1R,2S)-2-(5,9-dimethyldec-8-enyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid |
| SMILES | C=C1CC[C@H](CCCCC(C)CCC=C(C)C)[C@H]1C[C@H]1OC1CC(OC1CCCCO1)=C(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C35H56O7/c1-24(2)12-11-14-25(3)13-5-6-15-27-19-18-26(4)28(27)22-29-30(40-29)23-31(41-32-16-7-9-20-38-32)34(35(36)37)42-33-17-8-10-21-39-33/h12,25,27-30,32-33H,4-11,13-23H2,1-3H3,(H,36,37)/t25?,27-,28-,29+,30?,32?,33?/m0/s1 |
| InChIKey | QRNLJAIZUPEMML-BYYFDFMTSA-N |
| XLogP | 8.44 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|