C31H43NO7 — CID 54069843
4-[(3R)-3-[[(1R,2S)-2-(4-anilinobutyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxolan-2-yloxy)but-2-enoic acid (PubChem CID 54069843) has the molecular formula C31H43NO7 and a molecular weight of 541.69 g/mol. Its IUPAC name is 4-[(3R)-3-[[(1R,2S)-2-(4-anilinobutyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxolan-2-yloxy)but-2-enoic acid.
| Compound Name | 4-[(3R)-3-[[(1R,2S)-2-(4-anilinobutyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxolan-2-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 54069843 |
| Molecular Formula | C31H43NO7 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | 4-[(3R)-3-[[(1R,2S)-2-(4-anilinobutyl)-5-methylidenecyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxolan-2-yloxy)but-2-enoic acid |
| SMILES | C=C1CC[C@H](CCCCNc2ccccc2)[C@H]1C[C@H]1OC1CC(OC1CCCO1)=C(OC1CCCO1)C(=O)O |
| InChI | InChI=1S/C31H43NO7/c1-21-14-15-22(9-5-6-16-32-23-10-3-2-4-11-23)24(21)19-25-26(37-25)20-27(38-28-12-7-17-35-28)30(31(33)34)39-29-13-8-18-36-29/h2-4,10-11,22,24-26,28-29,32H,1,5-9,12-20H2,(H,33,34)/t22-,24-,25+,26?,28?,29?/m0/s1 |
| InChIKey | MFQLTEQAKFQFED-VPMYGSCCSA-N |
| XLogP | 6.00 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|