C30H48O7 — CID 57224512
7-[(1R,2R,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-3-(oxan-2-yloxy)-4-oxohept-2-enoic acid (PubChem CID 57224512) has the molecular formula C30H48O7 and a molecular weight of 520.71 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-3-(oxan-2-yloxy)-4-oxohept-2-enoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-3-(oxan-2-yloxy)-4-oxohept-2-enoic acid |
|---|---|
| PubChem CID | 57224512 |
| Molecular Formula | C30H48O7 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | 7-[(1R,2R,5S)-2-acetyloxy-5-(9-methyldec-8-enyl)cyclopentyl]-3-(oxan-2-yloxy)-4-oxohept-2-enoic acid |
| SMILES | CC(=O)O[C@@H]1CC[C@H](CCCCCCCC=C(C)C)[C@H]1CCCC(=O)C(=CC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C30H48O7/c1-22(2)13-8-6-4-5-7-9-14-24-18-19-27(36-23(3)31)25(24)15-12-16-26(32)28(21-29(33)34)37-30-17-10-11-20-35-30/h13,21,24-25,27,30H,4-12,14-20H2,1-3H3,(H,33,34)/t24-,25+,27+,30?/m0/s1 |
| InChIKey | SRKBIHHRHPNWQU-FDBSBURWSA-N |
| XLogP | 6.89 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|