C17H35NO2Si — CID 54130190
(3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-trimethyl-5-propan-2-ylpyrrolidin-2-one (PubChem CID 54130190) has the molecular formula C17H35NO2Si and a molecular weight of 313.56 g/mol. Its IUPAC name is (3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-trimethyl-5-propan-2-ylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-trimethyl-5-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 54130190 |
| Molecular Formula | C17H35NO2Si |
| Molecular Weight | 313.56 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-trimethyl-5-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)[C@]1(CO[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](C)C(=O)N1C |
| InChI | InChI=1S/C17H35NO2Si/c1-12(2)17(11-20-21(9,10)16(5,6)7)14(4)13(3)15(19)18(17)8/h12-14H,11H2,1-10H3/t13-,14+,17-/m1/s1 |
| InChIKey | NTUIXOSLNKGZCV-JKIFEVAISA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|