C15H27NO4Si — CID 11392848
methyl (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-methylidene-5-oxopyrrolidine-2-carboxylate (PubChem CID 11392848) has the molecular formula C15H27NO4Si and a molecular weight of 313.47 g/mol. Its IUPAC name is methyl (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-methylidene-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-methylidene-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11392848 |
| Molecular Formula | C15H27NO4Si |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-methylidene-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=C1[C@H](C)C(=O)N[C@@]1(CO[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C15H27NO4Si/c1-10-11(2)15(13(18)19-6,16-12(10)17)9-20-21(7,8)14(3,4)5/h10H,2,9H2,1,3-8H3,(H,16,17)/t10-,15+/m0/s1 |
| InChIKey | CQCZGUHADMKRBJ-ZUZCIYMTSA-N |
| XLogP | 2.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|