C15H25NO4 — CID 54132468
11-(2,5-dihydroxypyrrol-1-yl)undecanoic acid (PubChem CID 54132468) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 11-(2,5-dihydroxypyrrol-1-yl)undecanoic acid.
| Compound Name | 11-(2,5-dihydroxypyrrol-1-yl)undecanoic acid |
|---|---|
| PubChem CID | 54132468 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 11-(2,5-dihydroxypyrrol-1-yl)undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCn1c(O)ccc1O |
| InChI | InChI=1S/C15H25NO4/c17-13-10-11-14(18)16(13)12-8-6-4-2-1-3-5-7-9-15(19)20/h10-11,17-18H,1-9,12H2,(H,19,20) |
| InChIKey | NVHULGGEQGXCOL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|