C28H31F3N2O2 — CID 54136081
2-[5-benzhydryl-4-[2-methoxy-N-methyl-5-(trifluoromethyl)anilino]pyrrolidin-3-yl]ethanol (PubChem CID 54136081) has the molecular formula C28H31F3N2O2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[5-benzhydryl-4-[2-methoxy-N-methyl-5-(trifluoromethyl)anilino]pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[5-benzhydryl-4-[2-methoxy-N-methyl-5-(trifluoromethyl)anilino]pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 54136081 |
| Molecular Formula | C28H31F3N2O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-[5-benzhydryl-4-[2-methoxy-N-methyl-5-(trifluoromethyl)anilino]pyrrolidin-3-yl]ethanol |
| SMILES | COc1ccc(C(F)(F)F)cc1N(C)C1C(CCO)CNC1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31F3N2O2/c1-33(23-17-22(28(29,30)31)13-14-24(23)35-2)27-21(15-16-34)18-32-26(27)25(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,17,21,25-27,32,34H,15-16,18H2,1-2H3 |
| InChIKey | NXTZRSJICKOZLQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |