C14H24O7 — CID 54138862
2-carboxyoxyethyl 3-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoate (PubChem CID 54138862) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-carboxyoxyethyl 3-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoate.
| Compound Name | 2-carboxyoxyethyl 3-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoate |
|---|---|
| PubChem CID | 54138862 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-carboxyoxyethyl 3-(2,4,4-trimethylpentan-2-ylperoxy)prop-2-enoate |
| SMILES | CC(C)(C)CC(C)(C)OOC=CC(=O)OCCOC(=O)O |
| InChI | InChI=1S/C14H24O7/c1-13(2,3)10-14(4,5)21-20-7-6-11(15)18-8-9-19-12(16)17/h6-7H,8-10H2,1-5H3,(H,16,17) |
| InChIKey | NZQYTVCGWJZBKK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|