C17H13N3O6S2 — CID 54142630
1-phenyl-2-[2-(1,3,5-triazin-2-yl)phenyl]ethene-1,2-disulfonic acid (PubChem CID 54142630) has the molecular formula C17H13N3O6S2 and a molecular weight of 419.44 g/mol. Its IUPAC name is 1-phenyl-2-[2-(1,3,5-triazin-2-yl)phenyl]ethene-1,2-disulfonic acid.
| Compound Name | 1-phenyl-2-[2-(1,3,5-triazin-2-yl)phenyl]ethene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 54142630 |
| Molecular Formula | C17H13N3O6S2 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 1-phenyl-2-[2-(1,3,5-triazin-2-yl)phenyl]ethene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)C(=C(c1ccccc1-c1ncncn1)S(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H13N3O6S2/c21-27(22,23)15(12-6-2-1-3-7-12)16(28(24,25)26)13-8-4-5-9-14(13)17-19-10-18-11-20-17/h1-11H,(H,21,22,23)(H,24,25,26) |
| InChIKey | OCDLREITGMSCSS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|