C14H16Cl2NO+ — CID 54145091
(2,2-dichloroacetyl)-phenyl-bis(prop-2-enyl)azanium (PubChem CID 54145091) has the molecular formula C14H16Cl2NO+ and a molecular weight of 285.19 g/mol. Its IUPAC name is (2,2-dichloroacetyl)-phenyl-bis(prop-2-enyl)azanium.
| Compound Name | (2,2-dichloroacetyl)-phenyl-bis(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 54145091 |
| Molecular Formula | C14H16Cl2NO+ |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (2,2-dichloroacetyl)-phenyl-bis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(C(=O)C(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H16Cl2NO/c1-3-10-17(11-4-2,14(18)13(15)16)12-8-6-5-7-9-12/h3-9,13H,1-2,10-11H2/q+1 |
| InChIKey | YQAPITREHKUMRD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|