C12H17NO4 — CID 54145549
diethyl 6-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54145549) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is diethyl 6-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 6-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54145549 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | diethyl 6-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=CC(C(=O)OCC)C1 |
| InChI | InChI=1S/C12H17NO4/c1-4-16-11(14)9-6-10(8(3)13-7-9)12(15)17-5-2/h7,9H,4-6H2,1-3H3 |
| InChIKey | OECZCGKTRNUXQB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |