C7H10N2O3 — CID 57152034
ethyl 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 57152034) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is ethyl 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 57152034 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | ethyl 2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1C=NC(=O)NC1 |
| InChI | InChI=1S/C7H10N2O3/c1-2-12-6(10)5-3-8-7(11)9-4-5/h3,5H,2,4H2,1H3,(H,9,11) |
| InChIKey | LWYFRFZRDNTQCX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |