C12H13NO2S — CID 70967153
ethyl 5-pyridin-4-yl-2,3-dihydrothiophene-3-carboxylate (PubChem CID 70967153) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is ethyl 5-pyridin-4-yl-2,3-dihydrothiophene-3-carboxylate.
| Compound Name | ethyl 5-pyridin-4-yl-2,3-dihydrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 70967153 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | ethyl 5-pyridin-4-yl-2,3-dihydrothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1C=C(c2ccncc2)SC1 |
| InChI | InChI=1S/C12H13NO2S/c1-2-15-12(14)10-7-11(16-8-10)9-3-5-13-6-4-9/h3-7,10H,2,8H2,1H3 |
| InChIKey | LPSKCOUHIRGKFA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |