C8H11Cl3O3 — CID 54146770
(2R,6R)-5-ethyl-6-methyl-2-(trichloromethyl)-1,3-dioxan-4-one (PubChem CID 54146770) has the molecular formula C8H11Cl3O3 and a molecular weight of 261.53 g/mol. Its IUPAC name is (2R,6R)-5-ethyl-6-methyl-2-(trichloromethyl)-1,3-dioxan-4-one.
| Compound Name | (2R,6R)-5-ethyl-6-methyl-2-(trichloromethyl)-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 54146770 |
| Molecular Formula | C8H11Cl3O3 |
| Molecular Weight | 261.53 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | (2R,6R)-5-ethyl-6-methyl-2-(trichloromethyl)-1,3-dioxan-4-one |
| SMILES | CCC1C(=O)O[C@H](C(Cl)(Cl)Cl)O[C@@H]1C |
| InChI | InChI=1S/C8H11Cl3O3/c1-3-5-4(2)13-7(8(9,10)11)14-6(5)12/h4-5,7H,3H2,1-2H3/t4-,5?,7-/m1/s1 |
| InChIKey | OEXUZMRTWARAHP-TWQFUJJMSA-N |
| XLogP | 2.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|