C32H49NO5 — CID 54158684
[8-[3,5-dihydroxy-7-[(4-methoxyphenyl)methylamino]heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 54158684) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is [8-[3,5-dihydroxy-7-[(4-methoxyphenyl)methylamino]heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[3,5-dihydroxy-7-[(4-methoxyphenyl)methylamino]heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 54158684 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | [8-[3,5-dihydroxy-7-[(4-methoxyphenyl)methylamino]heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(O)CCNCc3ccc(OC)cc3)C21 |
| InChI | InChI=1S/C32H49NO5/c1-6-22(3)32(36)38-30-18-21(2)17-25-10-7-23(4)29(31(25)30)14-11-26(34)19-27(35)15-16-33-20-24-8-12-28(37-5)13-9-24/h7-10,12-13,17,21-23,26-27,29-31,33-35H,6,11,14-16,18-20H2,1-5H3 |
| InChIKey | OMWQULFXWDKUQU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|