C10H13NO5S — CID 54159553
2-acetylsulfanyl-2-(2,5-dihydroxypyrrol-1-yl)butanoic acid (PubChem CID 54159553) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-acetylsulfanyl-2-(2,5-dihydroxypyrrol-1-yl)butanoic acid.
| Compound Name | 2-acetylsulfanyl-2-(2,5-dihydroxypyrrol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 54159553 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-acetylsulfanyl-2-(2,5-dihydroxypyrrol-1-yl)butanoic acid |
| SMILES | CCC(SC(C)=O)(C(=O)O)n1c(O)ccc1O |
| InChI | InChI=1S/C10H13NO5S/c1-3-10(9(15)16,17-6(2)12)11-7(13)4-5-8(11)14/h4-5,13-14H,3H2,1-2H3,(H,15,16) |
| InChIKey | ONLVHUKEZHEVGH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|