C22H15F3IN3O — CID 54162273
N-[2-iodo-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]quinazolin-4-amine (PubChem CID 54162273) has the molecular formula C22H15F3IN3O and a molecular weight of 521.28 g/mol. Its IUPAC name is N-[2-iodo-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]quinazolin-4-amine.
| Compound Name | N-[2-iodo-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 54162273 |
| Molecular Formula | C22H15F3IN3O |
| Molecular Weight | 521.28 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | N-[2-iodo-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1cccc(COc2ccc(Nc3ncnc4ccccc34)c(I)c2)c1 |
| InChI | InChI=1S/C22H15F3IN3O/c23-22(24,25)15-5-3-4-14(10-15)12-30-16-8-9-20(18(26)11-16)29-21-17-6-1-2-7-19(17)27-13-28-21/h1-11,13H,12H2,(H,27,28,29) |
| InChIKey | OPGIQTIRQYSQBJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.28 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|