C19H33N5O7 — CID 54166080
(4S)-4-[[(4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoyl]-(6-aminohexanoyl)amino]-5-oxopentanoic acid (PubChem CID 54166080) has the molecular formula C19H33N5O7 and a molecular weight of 443.50 g/mol. Its IUPAC name is (4S)-4-[[(4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoyl]-(6-aminohexanoyl)amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoyl]-(6-aminohexanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54166080 |
| Molecular Formula | C19H33N5O7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | (4S)-4-[[(4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoyl]-(6-aminohexanoyl)amino]-5-oxopentanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@H](CCC(=O)N(C(=O)CCCCCN)[C@H](C=O)CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C19H33N5O7/c1-12(21)19(31)23-14(18(22)30)7-8-16(27)24(13(11-25)6-9-17(28)29)15(26)5-3-2-4-10-20/h11-14H,2-10,20-21H2,1H3,(H2,22,30)(H,23,31)(H,28,29)/t12-,13-,14+/m0/s1 |
| InChIKey | GTAPGCLBVORDLZ-MELADBBJSA-N |
| XLogP | -1.61 |
| TPSA | 215.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|