C39H64O4 — CID 54169442
2-(1-adamantyl)acetic acid;4-(3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid (PubChem CID 54169442) has the molecular formula C39H64O4 and a molecular weight of 596.94 g/mol. Its IUPAC name is 2-(1-adamantyl)acetic acid;4-(3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid.
| Compound Name | 2-(1-adamantyl)acetic acid;4-(3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid |
|---|---|
| PubChem CID | 54169442 |
| Molecular Formula | C39H64O4 |
| Molecular Weight | 596.94 g/mol |
| Exact Mass | 596.48 |
| IUPAC Name | 2-(1-adamantyl)acetic acid;4-(3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid |
| SMILES | CC1CCC2(C)C(C1)CC(C)C1C2CC(C)C2(C)C(C(C)CCC(=O)O)CCC12.O=C(O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H46O2.C12H18O2/c1-16-11-12-26(5)20(13-16)14-18(3)25-22-9-8-21(17(2)7-10-24(28)29)27(22,6)19(4)15-23(25)26;13-11(14)7-12-4-8-1-9(5-12)3-10(2-8)6-12/h16-23,25H,7-15H2,1-6H3,(H,28,29);8-10H,1-7H2,(H,13,14) |
| InChIKey | OTYYPJAACBEWSY-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.94 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |