C16H29N3 — CID 54173781
2-methyl-9-octyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine (PubChem CID 54173781) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-methyl-9-octyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine.
| Compound Name | 2-methyl-9-octyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine |
|---|---|
| PubChem CID | 54173781 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 2-methyl-9-octyl-5,6,7,8-tetrahydroimidazo[1,2-a][1,3]diazepine |
| SMILES | CCCCCCCCN1CCCCn2cc(C)nc21 |
| InChI | InChI=1S/C16H29N3/c1-3-4-5-6-7-8-11-18-12-9-10-13-19-14-15(2)17-16(18)19/h14H,3-13H2,1-2H3 |
| InChIKey | OWVMRVSEOMWCLJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|