C33H36N2O5 — CID 54179721
ethyl 6-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-7-yl]oxyhexanoate (PubChem CID 54179721) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is ethyl 6-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-7-yl]oxyhexanoate.
| Compound Name | ethyl 6-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-7-yl]oxyhexanoate |
|---|---|
| PubChem CID | 54179721 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | ethyl 6-[2-ethyl-1-oxamoyl-3-[(2-phenylphenyl)methyl]indolizin-7-yl]oxyhexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccn2c(Cc3ccccc3-c3ccccc3)c(CC)c(C(=O)C(N)=O)c2c1 |
| InChI | InChI=1S/C33H36N2O5/c1-3-26-28(21-24-15-10-11-16-27(24)23-13-7-5-8-14-23)35-19-18-25(22-29(35)31(26)32(37)33(34)38)40-20-12-6-9-17-30(36)39-4-2/h5,7-8,10-11,13-16,18-19,22H,3-4,6,9,12,17,20-21H2,1-2H3,(H2,34,38) |
| InChIKey | PAYIWUPZLOUPNF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|