C14H17NO4 — CID 54184692
(2R,7R)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene (PubChem CID 54184692) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2R,7R)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene.
| Compound Name | (2R,7R)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene |
|---|---|
| PubChem CID | 54184692 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2R,7R)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene |
| SMILES | CN1CCO[C@@H]2c3ccc4c(c3OCC[C@H]21)OCO4 |
| InChI | InChI=1S/C14H17NO4/c1-15-5-7-17-12-9-2-3-11-14(19-8-18-11)13(9)16-6-4-10(12)15/h2-3,10,12H,4-8H2,1H3/t10-,12-/m1/s1 |
| InChIKey | PEGUOULELYRUBH-ZYHUDNBSSA-N |
| XLogP | 1.57 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |