C28H29F2N3O4 — CID 54203120
N-[(3S,4S)-1-[4,4-bis(4-fluorophenyl)butyl]-3-hydroxypiperidin-4-yl]-4-nitrobenzamide (PubChem CID 54203120) has the molecular formula C28H29F2N3O4 and a molecular weight of 509.55 g/mol. Its IUPAC name is N-[(3S,4S)-1-[4,4-bis(4-fluorophenyl)butyl]-3-hydroxypiperidin-4-yl]-4-nitrobenzamide.
| Compound Name | N-[(3S,4S)-1-[4,4-bis(4-fluorophenyl)butyl]-3-hydroxypiperidin-4-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 54203120 |
| Molecular Formula | C28H29F2N3O4 |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[(3S,4S)-1-[4,4-bis(4-fluorophenyl)butyl]-3-hydroxypiperidin-4-yl]-4-nitrobenzamide |
| SMILES | O=C(N[C@H]1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)C[C@@H]1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29F2N3O4/c29-22-9-3-19(4-10-22)25(20-5-11-23(30)12-6-20)2-1-16-32-17-15-26(27(34)18-32)31-28(35)21-7-13-24(14-8-21)33(36)37/h3-14,25-27,34H,1-2,15-18H2,(H,31,35)/t26-,27-/m0/s1 |
| InChIKey | PQPWNVHQWWWSIC-SVBPBHIXSA-N |
| XLogP | 4.65 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|