C22H29N7O8 — CID 54203540
(3S)-3-acetamido-4-[[(1S)-1-carboxy-2-phenylethyl]-[5-[3-(diaminomethylideneamino)propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]amino]-4-oxobutanoic acid (PubChem CID 54203540) has the molecular formula C22H29N7O8 and a molecular weight of 519.52 g/mol. Its IUPAC name is (3S)-3-acetamido-4-[[(1S)-1-carboxy-2-phenylethyl]-[5-[3-(diaminomethylideneamino)propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-acetamido-4-[[(1S)-1-carboxy-2-phenylethyl]-[5-[3-(diaminomethylideneamino)propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54203540 |
| Molecular Formula | C22H29N7O8 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (3S)-3-acetamido-4-[[(1S)-1-carboxy-2-phenylethyl]-[5-[3-(diaminomethylideneamino)propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N([C@@H](Cc1ccccc1)C(=O)O)n1c(O)c(CCCN=C(N)N)[nH]c1=O |
| InChI | InChI=1S/C22H29N7O8/c1-12(30)26-15(11-17(31)32)19(34)28(16(20(35)36)10-13-6-3-2-4-7-13)29-18(33)14(27-22(29)37)8-5-9-25-21(23)24/h2-4,6-7,15-16,33H,5,8-11H2,1H3,(H,26,30)(H,27,37)(H,31,32)(H,35,36)(H4,23,24,25)/t15-,16-/m0/s1 |
| InChIKey | PQXJKLHHVKAFCK-HOTGVXAUSA-N |
| XLogP | -1.77 |
| TPSA | 246.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|