C19H31N7O8 — CID 54535479
(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]-[4-[3-(diaminomethylideneamino)propyl]-5-hydroxy-3-methyl-2-oxoimidazol-1-yl]amino]-3-methylbutanoic acid (PubChem CID 54535479) has the molecular formula C19H31N7O8 and a molecular weight of 485.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]-[4-[3-(diaminomethylideneamino)propyl]-5-hydroxy-3-methyl-2-oxoimidazol-1-yl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]-[4-[3-(diaminomethylideneamino)propyl]-5-hydroxy-3-methyl-2-oxoimidazol-1-yl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54535479 |
| Molecular Formula | C19H31N7O8 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]-[4-[3-(diaminomethylideneamino)propyl]-5-hydroxy-3-methyl-2-oxoimidazol-1-yl]amino]-3-methylbutanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N([C@H](C(=O)O)C(C)C)n1c(O)c(CCCN=C(N)N)n(C)c1=O |
| InChI | InChI=1S/C19H31N7O8/c1-9(2)14(17(32)33)25(15(30)11(8-13(28)29)23-10(3)27)26-16(31)12(24(4)19(26)34)6-5-7-22-18(20)21/h9,11,14,31H,5-8H2,1-4H3,(H,23,27)(H,28,29)(H,32,33)(H4,20,21,22)/t11-,14-/m0/s1 |
| InChIKey | YZMCJZPYSMGXAB-FZMZJTMJSA-N |
| XLogP | -2.35 |
| TPSA | 235.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|