C36H44ClN8O4+ — CID 54206893
[5-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]-6-formyl-1-oxidopyridin-1-ium-2-yl]methyl-diethyl-hydroxyazanium (PubChem CID 54206893) has the molecular formula C36H44ClN8O4+ and a molecular weight of 688.25 g/mol. Its IUPAC name is [5-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]-6-formyl-1-oxidopyridin-1-ium-2-yl]methyl-diethyl-hydroxyazanium.
| Compound Name | [5-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]-6-formyl-1-oxidopyridin-1-ium-2-yl]methyl-diethyl-hydroxyazanium |
|---|---|
| PubChem CID | 54206893 |
| Molecular Formula | C36H44ClN8O4+ |
| Molecular Weight | 688.25 g/mol |
| Exact Mass | 687.32 |
| IUPAC Name | [5-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]-6-formyl-1-oxidopyridin-1-ium-2-yl]methyl-diethyl-hydroxyazanium |
| SMILES | CCCCc1nc(Cl)c(-c2ccc(C[N+](O)(CC)CC)[n+]([O-])c2C=O)n1Cc1ccc(-c2ccccc2-c2nnnn2C(C)OCC)cc1 |
| InChI | InChI=1S/C36H44ClN8O4/c1-6-10-15-33-38-35(37)34(31-21-20-28(44(47)32(31)24-46)23-45(48,7-2)8-3)42(33)22-26-16-18-27(19-17-26)29-13-11-12-14-30(29)36-39-40-41-43(36)25(5)49-9-4/h11-14,16-21,24-25,48H,6-10,15,22-23H2,1-5H3/q+1 |
| InChIKey | UUFVIBWAMAQIPO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.25 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|