C31H31BrClN7O3 — CID 22914907
(6-bromo-1-oxidopyridin-1-ium-2-yl)-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanone (PubChem CID 22914907) has the molecular formula C31H31BrClN7O3 and a molecular weight of 664.99 g/mol. Its IUPAC name is (6-bromo-1-oxidopyridin-1-ium-2-yl)-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanone.
| Compound Name | (6-bromo-1-oxidopyridin-1-ium-2-yl)-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 22914907 |
| Molecular Formula | C31H31BrClN7O3 |
| Molecular Weight | 664.99 g/mol |
| Exact Mass | 663.14 |
| IUPAC Name | (6-bromo-1-oxidopyridin-1-ium-2-yl)-[2-butyl-5-chloro-3-[[4-[2-[1-(1-ethoxyethyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanone |
| SMILES | CCCCc1nc(Cl)c(C(=O)c2cccc(Br)[n+]2[O-])n1Cc1ccc(-c2ccccc2-c2nnnn2C(C)OCC)cc1 |
| InChI | InChI=1S/C31H31BrClN7O3/c1-4-6-14-27-34-30(33)28(29(41)25-12-9-13-26(32)40(25)42)38(27)19-21-15-17-22(18-16-21)23-10-7-8-11-24(23)31-35-36-37-39(31)20(3)43-5-2/h7-13,15-18,20H,4-6,14,19H2,1-3H3 |
| InChIKey | GOJFSCBEZBDDBW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.99 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|