C17H22N2 — CID 54208539
10,15,16-trimethyl-7,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,7-tetraene (PubChem CID 54208539) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 10,15,16-trimethyl-7,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,7-tetraene.
| Compound Name | 10,15,16-trimethyl-7,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,7-tetraene |
|---|---|
| PubChem CID | 54208539 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 10,15,16-trimethyl-7,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,7-tetraene |
| SMILES | CC1C2CC3=C(CCC4=C3C=C/N=C\CC41C)N2C |
| InChI | InChI=1S/C17H22N2/c1-11-16-10-13-12-6-8-18-9-7-17(11,2)14(12)4-5-15(13)19(16)3/h6,8-9,11,16H,4-5,7,10H2,1-3H3/b8-6?,18-9- |
| InChIKey | PUGRAKOPUZOFKT-JNDPZMKHSA-N |
| XLogP | 3.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |