C21H30OSSi — CID 54216367
[8-(1-benzothiophen-2-yl)-2-ethenyloct-1-enoxy]-trimethylsilane (PubChem CID 54216367) has the molecular formula C21H30OSSi and a molecular weight of 358.62 g/mol. Its IUPAC name is [8-(1-benzothiophen-2-yl)-2-ethenyloct-1-enoxy]-trimethylsilane.
| Compound Name | [8-(1-benzothiophen-2-yl)-2-ethenyloct-1-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 54216367 |
| Molecular Formula | C21H30OSSi |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [8-(1-benzothiophen-2-yl)-2-ethenyloct-1-enoxy]-trimethylsilane |
| SMILES | C=CC(=CO[Si](C)(C)C)CCCCCCc1cc2ccccc2s1 |
| InChI | InChI=1S/C21H30OSSi/c1-5-18(17-22-24(2,3)4)12-8-6-7-9-14-20-16-19-13-10-11-15-21(19)23-20/h5,10-11,13,15-17H,1,6-9,12,14H2,2-4H3 |
| InChIKey | PZLXRWIQZRCLAW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|