C31H22F6N2O6 — CID 54222903
5-(3-acetylbenzoyl)-2-methylisoindole-1,3-dione;5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylisoindole-1,3-dione (PubChem CID 54222903) has the molecular formula C31H22F6N2O6 and a molecular weight of 632.51 g/mol. Its IUPAC name is 5-(3-acetylbenzoyl)-2-methylisoindole-1,3-dione;5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylisoindole-1,3-dione.
| Compound Name | 5-(3-acetylbenzoyl)-2-methylisoindole-1,3-dione;5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 54222903 |
| Molecular Formula | C31H22F6N2O6 |
| Molecular Weight | 632.51 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | 5-(3-acetylbenzoyl)-2-methylisoindole-1,3-dione;5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylisoindole-1,3-dione |
| SMILES | CC(=O)c1cccc(C(=O)c2ccc3c(c2)C(=O)N(C)C3=O)c1.CN1C(=O)c2ccc(C(C)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C18H13NO4.C13H9F6NO2/c1-10(20)11-4-3-5-12(8-11)16(21)13-6-7-14-15(9-13)18(23)19(2)17(14)22;1-11(12(14,15)16,13(17,18)19)6-3-4-7-8(5-6)10(22)20(2)9(7)21/h3-9H,1-2H3;3-5H,1-2H3 |
| InChIKey | QDVURLNLMOLRNH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|