C22H32N4O6S — CID 54224110
4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzenesulfonic acid (PubChem CID 54224110) has the molecular formula C22H32N4O6S and a molecular weight of 480.59 g/mol. Its IUPAC name is 4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzenesulfonic acid.
| Compound Name | 4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54224110 |
| Molecular Formula | C22H32N4O6S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzenesulfonic acid |
| SMILES | CCCCCCCCC1(C2CNCCN2c2ccc(S(=O)(=O)O)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C22H32N4O6S/c1-2-3-4-5-6-7-12-22(19(27)24-21(29)25-20(22)28)18-15-23-13-14-26(18)16-8-10-17(11-9-16)33(30,31)32/h8-11,18,23H,2-7,12-15H2,1H3,(H,30,31,32)(H2,24,25,27,28,29) |
| InChIKey | QEQSFVOOAPEDQP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|